Details for 4-Tolylboronic acid
4-Tolylboronic acid
| 111Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
5720-05-8 |
| EC NO: |
|
| Molecular Formula: |
C9H13N |
| Molecular Weight: |
135.2062 |
| Specification: |
|
| InChI: |
InChI=1/C9H13N/c1-8(10-2)9-6-4-3-5-7-9/h3-8,10H,1-2H3/t8-/m1/s1 |
| Synonyms: |
AKOS BRN-0019;4-Tolylboronic Acid;4-Tolyboronic Acid;4-Methylphenylboric Acid;4-Methylphenylboronic Acid;P-Methylphenylboronic Acid;P-Tolylboronic Acid;(4-Methylphenyl)Boronic Acid;(1R)-N-Methyl-1-Phenylethanamine; |
| Molecular Structure: |
 |
if you are sourcing 4-Tolylboronic acid from China ,just feel free to inquire
CN
China Suppliers > bjpurechem > 
Search Product