Details for 5-Amino-1-methyl-1H-pyrazole-4-carboxylic acid ethyl ester

5-Amino-1-methyl-1H-pyrazole-4-carboxylic acid ethyl ester
| Category: |
Organic chemicals and Derivatives/Aliphatic compounds |
|
| CAS NO: |
31037-02-2 |
| EC NO: |
|
| Molecular Formula: |
C7H11N3O2 |
| Molecular Weight: |
169.1811 |
| Specification: |
|
| InChI: |
InChI=1/C7H11N3O2/c1-3-12-7(11)5-4-9-10(2)6(5)8/h4H,3,8H2,1-2H3 |
| Synonyms: |
Ethyl 5-amino-1-methyl-1H-pyrazole-4-carboxylate;Ethyl 5-amino-1-methylpyrazole-4-carboxylate;5-Amino-1-methylpyrazole-4-carboxylic acid ethyl ester;Amino-1-methyl-1H-pyrazole-4-carboxylic acid ethyl ester, 5-; |
| Molecular Structure: |
 |
if you are sourcing 5-Amino-1-methyl-1H-pyrazole-4-carboxylic acid ethyl ester from China ,just feel free to inquire