Details for 5-Bromo-2-chlorobenzoic acid
5-Bromo-2-chlorobenzoic acid
111Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
CAS NO: |
21739-92-4 |
EC NO: |
244-558-5 |
Molecular Formula: |
C7H3BrClO2 |
Molecular Weight: |
234.4551 |
Specification: |
|
InChI: |
InChI=1/C7H4BrClO2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,(H,10,11)/p-1 |
Synonyms: |
Benzoic acid, 5-bromo-2-chloro-;BCBA;2-chloropyridine-4-carbonitrile;5-bromo-2-chlorobenzoate;2-Chloro-5-bromobenzoic acid;5-Bromo-2-chloro-benzoic acid;5-Bromo-2-chloro benzoic acid; |
Molecular Structure: |
|
if you are sourcing 5-Bromo-2-chlorobenzoic acid from China ,just feel free to inquire