Details for Cyclohexylboronic Acid
Cyclohexylboronic Acid
| 111Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
4441-56-9 |
| EC NO: |
|
| Molecular Formula: |
C6H13BO2 |
| Molecular Weight: |
127.9772 |
| Specification: |
|
| InChI: |
InChI=1/C6H13BO2/c8-7(9)6-4-2-1-3-5-6/h6,8-9H,1-5H2 |
| Synonyms: |
Boronic acid, cyclohexyl- (9CI);4-16-00-01653 (Beilstein Handbook Reference);BRN 1921820;Cyclohexaneboronic acid;Boronicacid, B-cyclohexyl-; |
| Molecular Structure: |
 |
if you are sourcing Cyclohexylboronic Acid from China ,just feel free to inquire
CN
China Suppliers > bjpurechem > 
Search Product