Details for Dibenzofuran-4-Boronic acid
Dibenzofuran-4-Boronic acid
| 111Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
100124-06-9 |
| EC NO: |
|
| Molecular Formula: |
C6H5BF2O2 |
| Molecular Weight: |
157.9105 |
| Specification: |
|
| InChI: |
InChI=1/C6H5BF2O2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,10-11H |
| Synonyms: |
Dibenzofuran-4-boronic acid;Dibenzo[b,d]furan-4-ylboronic acid;(2,4-difluorophenyl)boronic acid;4-(Dibenzofuranyl)boronic acid;4-Dibenzofuranboronic acid; |
| Molecular Structure: |
 |
if you are sourcing Dibenzofuran-4-Boronic acid from China ,just feel free to inquire
CN
China Suppliers > bjpurechem > 
Search Product