Details for Diethyl 2-(2-cyanoethyl)malonate
![](/images/home/newal1.gif)
Diethyl 2-(2-cyanoethyl)malonate
111Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
CAS NO: |
17216-62-5 |
EC NO: |
241-260-7 |
Molecular Formula: |
C10H15NO4 |
Molecular Weight: |
213.2304 |
Specification: |
|
InChI: |
InChI=1/C10H15NO4/c1-3-14-9(12)8(6-5-7-11)10(13)15-4-2/h8H,3-6H2,1-2H3 |
Synonyms: |
4,4-Bis(ethoxycarbonyl)butyronitrile~2-Cyanoethylmalonic acid diethyl ester;Diethyl 2-cyanomalonate;Propanedioic acid, (2-cyanoethyl)-, diethyl ester;2-(2-CYANOETHYL)MALONIC ACID DIETHYL ESTER;(2-CYANOETHYL)MALONIC ACID DIETHYL ESTER;TIMTEC-BB SBB000530;diethyl (2-cyanoethyl)propanedioate; |
Molecular Structure: |
![Diethyl 2-(2-cyanoethyl)malonate 17216-62-5](https://images-a.chemnet.com/suppliers/chembase/482/4829.gif) |
if you are sourcing Diethyl 2-(2-cyanoethyl)malonate from China ,just feel free to inquire