Details for Ethyl diaceto acetate
Ethyl diaceto acetate
| 111Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
603-69-0 |
| EC NO: |
210-053-3 |
| Molecular Formula: |
C8H12O4 |
| Molecular Weight: |
172.1785 |
| Specification: |
|
| InChI: |
InChI=1/C8H12O4/c1-4-12-8(11)7(5(2)9)6(3)10/h11H,4H2,1-3H3 |
| Synonyms: |
Ethyl diacetoacetate, (3-Ethoxycarbonylacetyl acetone);3-Ethoxycarbonylacetylacetone;Diethyl diacetoacetate;2-Acetylacetoacetic acid ethyl ester;ethyl 2-acetyl-3-oxobutanoate;3-[ethoxy(hydroxy)methylidene]pentane-2,4-dione; |
| Molecular Structure: |
 |
if you are sourcing Ethyl diaceto acetate from China ,just feel free to inquire
CN
China Suppliers > bjpurechem > 
Search Product