Details for Naphthalene-2-boronic acid
Naphthalene-2-boronic acid
| 111Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
32316-92-0 |
| EC NO: |
|
| Molecular Formula: |
C10H9BO2 |
| Molecular Weight: |
171.9883 |
| Specification: |
|
| InChI: |
InChI=1/C10H9BO2/c12-11(13)10-6-5-8-3-1-2-4-9(8)7-10/h1-7,12-13H |
| Synonyms: |
2-Naphthylboronic acid;2-Naphthylboronic caid;2-Naphthalene Boric Acid;2-Naphthaleneylboronic acid;2-Naphthylbenzoic acid;2-Naphthaleneboronic acid;naphthalen-2-ylboronic acid;ALPHA-NAPHTHYLBORIC ACID;AKOS BRN-0020;AKOS BRN-0041;naphthalen-2-yl-2-boronic acid;Naphthalenyl-2-Boronic Acid;Naphthalenyl-2-Boronic Acid; |
| Molecular Structure: |
 |
if you are sourcing Naphthalene-2-boronic acid from China ,just feel free to inquire
CN
China Suppliers > bjpurechem > 
Search Product