Details for Phenylboronic acid neopentyl glycol ester
Phenylboronic acid neopentyl glycol ester
| 111Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
5123-13-7 |
| EC NO: |
|
| Molecular Formula: |
C11H15BO2 |
| Molecular Weight: |
190.0466 |
| Specification: |
|
| InChI: |
InChI=1/C11H15BO2/c1-11(2)8-13-12(14-9-11)10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3 |
| Synonyms: |
Phenylboronic acid neopentylglycol ester;(5,5-DIMETHYL-1,3,2-DIOXABORINAN-2-YL)BENZENE; |
| Molecular Structure: |
 |
if you are sourcing Phenylboronic acid neopentyl glycol ester from China ,just feel free to inquire
CN
China Suppliers > bjpurechem > 
Search Product