Details for Phenylethaneboronic acid
Phenylethaneboronic acid
| 111Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
34420-17-2 |
| EC NO: |
|
| Molecular Formula: |
C8H9BO2 |
| Molecular Weight: |
147.9669 |
| Specification: |
|
| InChI: |
InChI=1/C8H9BO2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7,10-11H/b7-6+ |
| Synonyms: |
Phenethylboronic acid;(2-phenylethyl)boronic acid;[(E)-2-phenylethenyl]boronic acid;2-Phenylethaneboronic acid;Phenylethaneboronic Acid; |
| Molecular Structure: |
 |
if you are sourcing Phenylethaneboronic acid from China ,just feel free to inquire
CN
China Suppliers > bjpurechem > 
Search Product