Details for n-Hexylboronic acid
n-Hexylboronic acid
| 111Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
16343-08-1 |
| EC NO: |
|
| Molecular Formula: |
C6H15BO2 |
| Molecular Weight: |
129.9931 |
| Specification: |
|
| InChI: |
InChI=1/C6H15BO2/c1-2-3-4-5-6-7(8)9/h8-9H,2-6H2,1H3 |
| Synonyms: |
HEXYLBORONIC ACID;N-HEXYLBORONIC ACID;RARECHEM AH PB 0225;N-HexaNeboroNic acid;Hexylboronicacid,min.97%;1-Hexylboronic acid, 97%;Hexylboronic Acid (contains varying amounts of Anhydride) |
| Molecular Structure: |
 |
if you are sourcing n-Hexylboronic acid from China ,just feel free to inquire
CN
China Suppliers > bjpurechem > 
Search Product