Details for Hexadecyl dimethyl amine
Hexadecyl dimethyl amine
| 111Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
112-69-6 |
| EC NO: |
203-997-2 |
| Molecular Formula: |
C18H39N |
| Molecular Weight: |
269.51 |
| Specification: |
|
| InChI: |
InChI=1/C18H39N/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(2)3/h4-18H2,1-3H3 |
| Synonyms: |
N,N-Dimethyl-n-hexadecylamine;Hexadecyl dimethyl amine;N,N-Dimethylpalmitylamine;1-(Dimethylamino)hexadecane;Dimethyl Hexadecyl Amine;DMA1697;Hexadecyldimethylamine; |
| Molecular Structure: |
 |
if you are sourcing Hexadecyl dimethyl amine from China ,just feel free to inquire
CN
China Suppliers > volantchem > 
Search Product