year
111Category: | Intermediates/Pharmaceutical intermediates |
|
|
CAS NO: | 3068-00-6 | ||
EC NO: | 221-323-5 | ||
Molecular Formula: | C4H10O3 | ||
Molecular Weight: | 106.1204 | ||
Specification: | 95%, 96%, 97%, 98% | ||
InChI: | InChI=1/C4H10O3/c5-2-1-4(7)3-6/h4-7H,1-3H2/t4-/m1/s1 | ||
Packing: | 200kg/drum (inside coated with epoxy resin) or 3kg/white glass bottle or 1kg, 10kg, 20kg/PVC drum. | ||
Product description:
|
|||
Uses: | 1. Important intermediates of medicine preparation; 2. Accessory ingredient of tobacco to reduce tar harm; 3. Accessory ingredient of photo developer to increase color degree and adhesive force power; 4. Accessory ingredient of high-grade ink; 5. Surfac | ||
Synonyms: | Butanetriol,97%;butane-1,2,4-triol;(2S)-butane-1,2,4-triol;(2R)-butane-1,2,4-triol; | ||
Molecular Structure: |