Details for Triethyl methanetricarboxylate
Triethyl methanetricarboxylate
| 111Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
| CAS NO: |
6279-86-3 |
| EC NO: |
228-477-2 |
| Molecular Formula: |
C10H16O6 |
| Molecular Weight: |
232.2304 |
| Specification: |
|
| InChI: |
InChI=1/C10H16O6/c1-4-14-8(11)7(9(12)15-5-2)10(13)16-6-3/h7H,4-6H2,1-3H3 |
| Synonyms: |
Methanetricarboxylic acid triethyl ester~Tris(carboethoxy)methane; |
| Molecular Structure: |
 |
if you are sourcing Triethyl methanetricarboxylate from China ,just feel free to inquire
CN
China Suppliers > sunfitchem > 
Search Product