Details for 4-chlorobutanal dimethyl acetal
![](/images/home/newal1.gif)
4-chlorobutanal dimethyl acetal
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
29882-07-3 |
EC NO: |
249-924-8 |
Molecular Formula: |
C6H13ClO2 |
Molecular Weight: |
152.6192 |
Specification: |
|
InChI: |
InChI=1/C6H13ClO2/c1-8-6(9-2)4-3-5-7/h6H,3-5H2,1-2H3 |
Synonyms: |
4-chlorobutyraldehyde dimethyl acetal;4-Chlorobutanal dimethyl acetal;4-chloro-1,1-dimethoxybutane;4-Chlorobutanal dimethyl acetal; |
Molecular Structure: |
![4-chlorobutanal dimethyl acetal 29882-07-3](https://images-a.chemnet.com/suppliers/chembase/cas/cas29882-07-3.gif) |
if you are sourcing 4-chlorobutanal dimethyl acetal from China ,just feel free to inquire