Details for ethyl 6-chlorohexanoate

ethyl 6-chlorohexanoate
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
10140-96-2 |
EC NO: |
233-400-0 |
Molecular Formula: |
C8H15ClO2 |
Molecular Weight: |
178.6565 |
Specification: |
|
InChI: |
InChI=1/C8H15ClO2/c1-2-11-8(10)6-4-3-5-7-9/h2-7H2,1H3 |
Synonyms: |
Hexanoic acid, 6-chloro-, ethyl ester;3-02-00-00735 (Beilstein Handbook Reference);6-Chlorohexanoic acid, ethyl ester;BRN 1756050;Ethyl 6-chlorohexanoate; |
Molecular Structure: |
 |
if you are sourcing ethyl 6-chlorohexanoate from China ,just feel free to inquire