Details for Diethyl ethylmalonate
![](/images/home/newal1.gif)
Diethyl ethylmalonate
111Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
CAS NO: |
133-13-1 |
EC NO: |
205-093-3 |
Molecular Formula: |
C9H16O4 |
Molecular Weight: |
188.2209 |
Specification: |
|
InChI: |
InChI=1/C9H16O4/c1-4-7(8(10)12-5-2)9(11)13-6-3/h7H,4-6H2,1-3H3 |
Synonyms: |
Ethylmalonic acid diethyl ester;Ethylpropanedioic acid diethyl ester;diethyl ethylpropanedioate; |
Molecular Structure: |
![Diethyl ethylmalonate 133-13-1](https://images-a.chemnet.com/suppliers/chembase/115/1153.gif) |
if you are sourcing Diethyl ethylmalonate from China ,just feel free to inquire