Details for 2-Chloronicotinic acid ethyl ester
2-Chloronicotinic acid ethyl ester
111Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
CAS NO: |
1452-94-4 |
EC NO: |
|
Molecular Formula: |
C8H8ClNO2 |
Molecular Weight: |
185.6076 |
Specification: |
|
InChI: |
InChI=1/C8H8ClNO2/c1-2-12-8(11)6-4-3-5-10-7(6)9/h3-5H,2H2,1H3 |
Synonyms: |
2-CHLORONICOTINIC ACID ETHYL ESTER;ethyl 2-chloropyridine-3-carboxylate; |
Molecular Structure: |
|
if you are sourcing 2-Chloronicotinic acid ethyl ester from United-States ,just feel free to inquire