Details for 2-Fluoronicotinic acid methyl ester
2-Fluoronicotinic acid methyl ester
111Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
CAS NO: |
446-26-4 |
EC NO: |
|
Molecular Formula: |
C7H6FNO2 |
Molecular Weight: |
155.1264 |
Specification: |
|
InChI: |
InChI=1/C7H6FNO2/c1-11-7(10)5-3-2-4-9-6(5)8/h2-4H,1H3 |
Synonyms: |
3-pyridinecarboxylic acid, 2-fluoro-, methyl ester;Methyl 2-fluoronicotinate;methyl 2-fluoropyridine-3-carboxylate;methyl 2-fluoro-3-pyridinecarboxylate; |
Molecular Structure: |
|
if you are sourcing 2-Fluoronicotinic acid methyl ester from United-States ,just feel free to inquire