Details for 4-fluoro-2-nitro benzoic acid
![](/images/home/newal1.gif)
4-fluoro-2-nitro benzoic acid
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
394-01-4 |
EC NO: |
206-890-9 |
Molecular Formula: |
C7H4FNO4 |
Molecular Weight: |
185.1094 |
Specification: |
|
InChI: |
InChI=1/C7H4FNO4/c8-4-1-2-5(7(10)11)6(3-4)9(12)13/h1-3H,(H,10,11) |
Synonyms: |
2-Nitro-4-Fluoroluere acid;BUTTPARK 45\01-65;4-FLUORO-2-NITROBENZOIC ACID;2-NITRO-4-FLUOROBENZOIC ACID;RARECHEM AL BO 1973;4-Fluoro-2-Nitrobenzoic Acid 2-Nitro-4-Fluorobenzoic Acid;2 4-Fluoro-2-Nitrobenzoic Acid;4-FLUORO-2-NITROBENZOIC ACID 98%;4-Fluoro-2-nitrobenzotc acid;4-fluoro-2-nitrobenzoate; |
Molecular Structure: |
![4-fluoro-2-nitro benzoic acid 394-01-4](https://images-a.chemnet.com/suppliers/chembase/172/172576_1.gif) |
if you are sourcing 4-fluoro-2-nitro benzoic acid from United-States ,just feel free to inquire