Details for 2-Methylbenzothiazole
2-Methylbenzothiazole
| 111Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
120-75-2 |
| EC NO: |
204-423-3 |
| Molecular Formula: |
C8H7NS |
| Molecular Weight: |
149.2129 |
| Specification: |
|
| InChI: |
InChI=1/C8H7NS/c1-6-9-7-4-2-3-5-8(7)10-6/h2-5H,1H3 |
| Synonyms: |
Benzothiazole, 2-methyl-;2-Methybenzothiazole;2-Methylbenzothiazole;4-27-00-01080 (Beilstein Handbook Reference);BRN 0112427;CCRIS 8096;NSC 3825;USAF EK-1853;2-methyl-1,3-benzothiazole; |
| Molecular Structure: |
 |
if you are sourcing 2-Methylbenzothiazole from China ,just feel free to inquire
CN
China Suppliers > yancui > 
Search Product