Details for 4-Chloro thiophenol
4-Chloro thiophenol
| 111Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
106-54-7 |
| EC NO: |
203-408-9 |
| Molecular Formula: |
C6H5ClS |
| Molecular Weight: |
144.6187 |
| Specification: |
|
| InChI: |
InChI=1/C6H5ClS/c7-5-1-3-6(8)4-2-5/h1-4,8H/p-1 |
| Synonyms: |
4-Chlorobenzenethiol;4-Chlorobenzenethiol;4-Cyano-Acetophonene/4-CA;4-Chloro thiophenol;Benzenethiol, p-chloro-;p-Chlorobenzenethiol;p-Chlorophenylmercaptan;p-Chlorothiophenol;p-Mercaptochlorobenzene;1-Chloro-4-mercaptobenzene;4-Chlorophenylmercaptan;p-Chlorthiofenol;Phenyl mercaptan, p-chloro-;4-chlorobenzenethiolate; |
| Molecular Structure: |
 |
if you are sourcing 4-Chloro thiophenol from China ,just feel free to inquire
CN
China Suppliers > yancui > 
Search Product