Details for Diethyl n-butylmalonate
Diethyl n-butylmalonate
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
133-08-4 |
EC NO: |
205-089-1 |
Molecular Formula: |
C11H20O4 |
Molecular Weight: |
216.2741 |
Specification: |
|
InChI: |
InChI=1/C11H20O4/c1-4-7-8-9(10(12)14-5-2)11(13)15-6-3/h9H,4-8H2,1-3H3 |
Synonyms: |
n-Butylammonic acid diethyl ester;n-Butylmalonic acid diethyl ester;diethyl butylmalonate;n-Butyl Diethyl Malonate;diethyl 2-butylpropanedioate; |
Molecular Structure: |
|
if you are sourcing Diethyl n-butylmalonate from China ,just feel free to inquire