Details for Diphenyl Oxide
Diphenyl Oxide
| 111Category: |
Organic chemicals and Derivatives/Alcohol and aether compounds |
|
| CAS NO: |
101-84-8 |
| EC NO: |
202-981-2 |
| Molecular Formula: |
C12H10O |
| Molecular Weight: |
170.2072 |
| Specification: |
|
| InChI: |
InChI=1/C12H10O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10H |
| Synonyms: |
1,1'-oxybisbenzene;diphenyl ether;Diphenyl Oxide;phenoxybenzene;1,1'-oxydibenzene;Dipnenyl ether;Di(diiphenyl) ether;Biphenyl oxide; |
| Molecular Structure: |
 |
if you are sourcing Diphenyl Oxide from China ,just feel free to inquire
CN
China Suppliers > yancui > 
Search Product