Details for Guanidine Hydrochloride
Guanidine Hydrochloride
| 111Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
50-01-1 |
| EC NO: |
200-002-3 |
| Molecular Formula: |
CH6N3Cl |
| Molecular Weight: |
95.5388 |
| Specification: |
|
| InChI: |
InChI=1/CH5N3.ClH/c2-1(3)4;/h(H5,2,3,4);1H/p+1 |
| Synonyms: |
Guanidine Chloride;Guanidinium chloride;Guanidine monohydrochloride;Guanidine HCl;guanidine hydrochloride (1:1);methanaminium, 1-amino-1-imino-, hydrochloride (1:1);Guanidine Hydrochlorie; |
| Molecular Structure: |
 |
if you are sourcing Guanidine Hydrochloride from China ,just feel free to inquire
CN
China Suppliers > yancui > 
Search Product