Details for Methyl Cinnamate
Methyl Cinnamate
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
103-26-4 |
EC NO: |
203-093-8 |
Molecular Formula: |
C10H10O2 |
Molecular Weight: |
162.1852 |
Specification: |
|
InChI: |
InChI=1/C10H10O2/c1-12-10(11)8-7-9-5-3-2-4-6-9/h2-8H,1H3/b8-7+ |
Synonyms: |
2-Propenoic acid, 3-phenyl-, methyl ester;Methyl 3-phenyl propenoate; METHYL CINNAMATE;NATURAL METHYL CINNAMATE;methyl 3-phenylprop-2-enoate;(2E)-3-phenyloct-2-enal;(2E)-3-(2-methylphenyl)prop-2-enoate;methyl (2Z)-3-phenylprop-2-enoate;methyl (E)-3-phenylprop-2-enoate; |
Molecular Structure: |
|
if you are sourcing Methyl Cinnamate from China ,just feel free to inquire