Details for Cellosolve Acetate
Cellosolve Acetate
111Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
CAS NO: |
111-15-9 |
EC NO: |
203-839-2 |
Molecular Formula: |
C6H12O3 |
Molecular Weight: |
132.17 |
Specification: |
|
InChI: |
InChI=1/C6H12O3/c1-3-8-4-5-9-6(2)7/h3-5H2,1-2H3 |
Synonyms: |
2EEA;2-Ethoxyethanol acetate;2-ethoxyethanol, ester with acetic acid;beta-ethoxyethyl acetate;Cellosolve acetate;CSAC;ektasolve ee acetate solvent;Ethoxyethanol acetate;Ethoxyethyl acetate;Ethyl acetyl glycolate;Ethyl Cellosolve Acetate;ethylene glycol ethyl ether acetate;Ethylene glycol monethyl ether acetate;Ethylene glycol monoethylether acetate;Ethylglycol acetate;glycol ether ee acetate;Glycol, monoethyl ether acetate;oxytol acetate;poly-solv ee acetate;Ethylene Glycol Monoethyl Ether Acetate;CAC;1-ethoxyethyl acetate;ethyl ethaneperoxoate; |
Molecular Structure: |
|
if you are sourcing Cellosolve Acetate from Other-Regions ,just feel free to inquire