Details for Ethyl Acetate
Ethyl Acetate
111Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
CAS NO: |
141-78-6 |
EC NO: |
205-500-4 |
Molecular Formula: |
C4H8O2 |
Molecular Weight: |
88.1051 |
Specification: |
|
InChI: |
InChI=1/C4H8O2/c1-3-6-4(2)5/h3H2,1-2H3 |
Synonyms: |
Acetic acid ethyl ester;ethyl acetate B&J brand 4 L;ETHYLACETATE ULTRA RESI-ANAL.;ETHYL ACETATE CAPILLARY GRADE;Ethyl Acetate Specially Purified - SPECIFIED;Acetic Ether;RFE;acetic ester;EAC; |
Molecular Structure: |
|
if you are sourcing Ethyl Acetate from Other-Regions ,just feel free to inquire