| 111Category: |
Fragrances and Aroma chemicals |
|
| CAS NO: |
3391-86-4 |
| EC NO: |
222-226-0 |
| Molecular Formula: |
C8H16O |
| Molecular Weight: |
128.212 |
| Specification: |
|
| InChI: |
InChI=1/C8H16O/c1-3-5-6-7-8(9)4-2/h4,8-9H,2-3,5-7H2,1H3/t8-/m0/s1 |
Product description:
| Appearance |
Odor |
Application |
| Achromatic to light yelloww, oily liquid |
Earth Flavor, Herb Aroma |
Seasonings, Essence Oil, Butter |
|
| Synonyms: |
3-Octenol;Flowtron mosquito attractant;Matsuka alcohol;Morillol;Mushroom alcohol;Octen-3-ol;Pentyl vintyl carbinol;Pentyl vinyl carbinol;Vinyl hexanol;Vinyl pentyl carbinol; ;oct-1-en-3-ol;(3S)-oct-1-en-3-ol;(3R)-oct-1-en-3-ol; |
| Molecular Structure: |
 |
CN
China Suppliers > tzrunlong > 
Search Product