Details for 3-(Methylthio) butanal
3-(Methylthio) butanal
111Category: |
Fragrances and Aroma chemicals |
|
CAS NO: |
16630-52-7 |
EC NO: |
240-678-7 |
Molecular Formula: |
C5H10OS |
Molecular Weight: |
118.1973 |
Specification: |
|
InChI: |
InChI=1/C5H10OS/c1-5(7-2)3-4-6/h4-5H,3H2,1-2H3/t5-/m1/s1 |
Product description:
Appearance |
Odor |
Application |
Achromatic to yellow liquid |
Pickles Flavor£¬ Vegetable Flavor |
Seasonings, Pickles£¬ Vegetables |
|
Synonyms: |
3-Methylthiobutanal;3-(methylsulfanyl)butanal;2-methyl-3-(methylsulfanyl)propanal;(3S)-3-(methylsulfanyl)butanal;(3R)-3-(methylsulfanyl)butanal;3-Methylthio butyraldehyde;3-(Methylthio)Butanal; |
Molecular Structure: |
|
if you are sourcing 3-(Methylthio) butanal from China ,just feel free to inquire