Details for 3-Acetylthio-2-Methylfuran
3-Acetylthio-2-Methylfuran
| 111Category: |
Fragrances and Aroma chemicals |
|
| CAS NO: |
55764-25-5 |
| EC NO: |
259-801-0 |
| Molecular Formula: |
C7H8O2S |
| Molecular Weight: |
156.2022 |
| Specification: |
|
| InChI: |
InChI=1/C7H8O2S/c1-5-7(3-4-9-5)10-6(2)8/h3-4H,1-2H3 |
Product description:
| Appearance |
Odor |
Application |
| Achromatic to red liquid |
Sauce Aroma￡? Meat Aroma￡? Burnt Aroma |
Meat Products, Seasonings, Vegetables￡? Fish and Shellfish Products |
|
| Synonyms: |
Ethanethioic acid, S-(2-methyl-3-furanyl) ester;S-(2-Methyl-3-furyl) ethanethioate;S-(2-methylfuran-3-yl) ethanethioate;2-Methyl-3-furanthiol acetate;S-(2-methyl-3-furyl)ethanethioate;2-Methylfuran-3-Thiol Acetate; |
| Molecular Structure: |
 |
if you are sourcing 3-Acetylthio-2-Methylfuran from China ,just feel free to inquire
CN
China Suppliers > tzrunlong > 
Search Product