Details for 3-Acetylthio-2-Methylfuran

3-Acetylthio-2-Methylfuran
111Category: |
Fragrances and Aroma chemicals |
|
CAS NO: |
55764-25-5 |
EC NO: |
259-801-0 |
Molecular Formula: |
C7H8O2S |
Molecular Weight: |
156.2022 |
Specification: |
|
InChI: |
InChI=1/C7H8O2S/c1-5-7(3-4-9-5)10-6(2)8/h3-4H,1-2H3 |
Product description:
Appearance |
Odor |
Application |
Achromatic to red liquid |
Sauce Aroma£? Meat Aroma£? Burnt Aroma |
Meat Products, Seasonings, Vegetables£? Fish and Shellfish Products |
|
Synonyms: |
Ethanethioic acid, S-(2-methyl-3-furanyl) ester;S-(2-Methyl-3-furyl) ethanethioate;S-(2-methylfuran-3-yl) ethanethioate;2-Methyl-3-furanthiol acetate;S-(2-methyl-3-furyl)ethanethioate;2-Methylfuran-3-Thiol Acetate; |
Molecular Structure: |
 |
if you are sourcing 3-Acetylthio-2-Methylfuran from China ,just feel free to inquire