| 111Category: |
Fragrances and Aroma chemicals |
|
| CAS NO: |
13327-56-5 |
| EC NO: |
236-370-7 |
| Molecular Formula: |
C6H12O2S |
| Molecular Weight: |
148.2233 |
| Specification: |
|
| InChI: |
InChI=1/C6H12O2S/c1-3-8-6(7)4-5-9-2/h3-5H2,1-2H3 |
Product description:
| Appearance |
Odor |
Application |
| Achromatic to pale yellow liquid |
Pineapple Aroma |
Beverages, Ice Foods, Roast Products, Candies, Jam |
|
| Synonyms: |
Propanoic acid, 3-(methylthio)-, ethyl ester;3-(Methylthio)propionic acid ethylester;Ethyl 3-(methylthio)propanoate;Ethyl 3-(methylthio)propionate;Ethyl 3-methylmercaptopropionate;Ethyl beta-methylthiopropionate;Ethyl methyl mercaptopropionate;Propionic acid, 3-(methylthio)-, ethyl ester;Ethyl 3-(methylthio)propionate;ethyl 3-(methylsulfanyl)propanoate;Ethyl-3-(methylthio) propionate; |
| Molecular Structure: |
 |
CN
China Suppliers > tzrunlong > 
Search Product