Details for Furfuryl thioacetate
Furfuryl thioacetate
| 111Category: |
Fragrances and Aroma chemicals |
|
| CAS NO: |
13678-68-7 |
| EC NO: |
237-173-9 |
| Molecular Formula: |
C7H8O2S |
| Molecular Weight: |
156.2022 |
| Specification: |
|
| InChI: |
InChI=1/C7H8O2S/c1-6(8)10-5-7-3-2-4-9-7/h2-4H,5H2,1H3 |
Product description:
| Appearance |
Odor |
Application |
| Yellow, oily liquid |
Rich Roast Coffee Aroma |
Beverages, Ice Foods, Candies |
|
| Synonyms: |
Ethanethioic acid, S-(2-furanylmethyl) ester; S-Furfuryl thioacetate;S-(furan-2-ylmethyl) ethanethioate;Furfuryl mercaptan acetate; |
| Molecular Structure: |
 |
if you are sourcing Furfuryl thioacetate from China ,just feel free to inquire
CN
China Suppliers > tzrunlong > 
Search Product