Details for Methyl Isovalerate

Methyl Isovalerate
111Category: |
Fragrances and Aroma chemicals |
|
CAS NO: |
556-24-1 |
EC NO: |
209-117-3 |
Molecular Formula: |
C6H11O2 |
Molecular Weight: |
115.1509 |
Specification: |
|
InChI: |
InChI=1/C6H12O2/c1-4(2)5(3)6(7)8/h4-5H,1-3H3,(H,7,8)/p-1 |
Synonyms: |
Isovaleric acid methyl ester~3-Methylbutyric acid methyl ester~Methyl isopentanoate~Methyl 3-methylbutyrate;Methyl isopentanoate;2-methylbutyl isovalerate;2,3-dimethylbutanoate; |
Molecular Structure: |
 |
if you are sourcing Methyl Isovalerate from China ,just feel free to inquire