Details for Milk Lactone

Milk Lactone
111Category: |
Fragrances and Aroma chemicals |
|
CAS NO: |
72881-27-7 |
EC NO: |
|
Molecular Formula: |
C10H18O2 |
Molecular Weight: |
170.25 |
Specification: |
|
InChI: |
InChI=1/C10H18O2/c1-2-3-4-5-6-7-8-9-10(11)12/h8-9H,2-7H2,1H3,(H,11,12)/b9-8+ |
Synonyms: |
5-(6)-Decenoic acids mixture;5-(6)-Decenoic acid;Mixture of 5-(6)-decenoic acids;5-(6)-Decenoic Acids Mixture;5-(6)-decylenic acid;5-and 6-Decenoic acid (Milk lactone); |
Molecular Structure: |
 |
if you are sourcing Milk Lactone from China ,just feel free to inquire