Details for Vanillyl ethyl ether

Vanillyl ethyl ether
111Category: |
Fragrances and Aroma chemicals |
|
CAS NO: |
13184-86-6 |
EC NO: |
236-136-4 |
Molecular Formula: |
C10H14O3 |
Molecular Weight: |
182.2164 |
Specification: |
|
InChI: |
InChI=1/C10H14O3/c1-3-13-7-8-4-5-9(11)10(6-8)12-2/h4-6,11H,3,7H2,1-2H3 |
Synonyms: |
236-136-4;alpha-Ethoxy-2-methoxy-P-cresol;Ethyl 4-hydroxy-3-methoxybenzyl ether;Ethyl vanillyl ether;P-Cresol, alpha-ethoxy-2-methoxy-;phenol, 4-(ethoxymethyl)-2-methoxy-;Vanillyl ethyl ether; |
Molecular Structure: |
 |
if you are sourcing Vanillyl ethyl ether from China ,just feel free to inquire