Details for Benzoic Acid

Benzoic Acid
Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
CAS NO: |
65-85-0 |
EC NO: |
200-618-2 |
Molecular Formula: |
C7H6O2 |
Molecular Weight: |
122.1224 |
Specification: |
|
InChI: |
InChI=1/C7H6O2/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H,8,9)/p-1 |
Synonyms: |
Melting point standard benzoic acid;Benzoic-12C7 acid, 13C-depleted;Benzoic acid, USP Grade;4-Carboxypolystyrene;benzoate;Industrial-use benzoic acid; |
Molecular Structure: |
 |
if you are sourcing Benzoic Acid from United-States ,just feel free to inquire