Details for 1,5-Dihydroxy Naphthalene
1,5-Dihydroxy Naphthalene
| 111Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
83-56-7 |
| EC NO: |
201-487-4 |
| Molecular Formula: |
C10H8O2 |
| Molecular Weight: |
160.1693 |
| Specification: |
|
| InChI: |
InChI=1/C10H8O2/c11-9-5-1-3-7-8(9)4-2-6-10(7)12/h1-6,11-12H |
| Synonyms: |
C.I. 76625;CI 76625;1,5-Naphthalenediol;1,5-dihydroxy naphthalene;naphthalene-1,5-diol;1,5-Dihydoroxy naphthalene; |
| Molecular Structure: |
 |
if you are sourcing 1,5-Dihydroxy Naphthalene from China ,just feel free to inquire
CN
China Suppliers > colorific-chem > 
Search Product