Details for Divinyl Benzene
Divinyl Benzene
| 111Category: |
Catalyst and Auxiliary |
|
| CAS NO: |
1321-74-0 |
| EC NO: |
215-325-5 |
| Molecular Formula: |
C20H20 |
| Molecular Weight: |
260.3728 |
| Specification: |
|
| InChI: |
InChI=1/2C10H10/c1-3-9-5-7-10(4-2)8-6-9;1-3-9-6-5-7-10(4-2)8-9/h2*3-8H,1-2H2 |
| Synonyms: |
divinylbenzene, mixture of isomers;divinylbenzene mixed isomers;divinylbenzene;Ethylvinyl Benzene;Divinylbenzenetechmixedisomers;Vinylethylbenzene; |
| Molecular Structure: |
 |
if you are sourcing Divinyl Benzene from China ,just feel free to inquire
CN
China Suppliers > colorific-chem > 
Search Product