Details for Methyl N-(2,6-dimethylphenyl)-alaninate
Methyl N-(2,6-dimethylphenyl)-alaninate
| 111Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
52888-49-0 |
| EC NO: |
258-237-2 |
| Molecular Formula: |
C12H17NO2 |
| Molecular Weight: |
207.2689 |
| Specification: |
|
| InChI: |
InChI=1/C12H17NO2/c1-8-6-5-7-9(2)11(8)13-10(3)12(14)15-4/h5-7,10,13H,1-4H3/t10-/m0/s1 |
| Synonyms: |
methyl N-(2,6-dimethylphenyl)alaninate;methyl N-(2,6-dimethylphenyl)-L-alaninate;N-(2,6-dimethylphenyl)alanine methyl ester; |
| Molecular Structure: |
 |
if you are sourcing Methyl N-(2,6-dimethylphenyl)-alaninate from China ,just feel free to inquire
CN
China Suppliers > colorific-chem > 
Search Product