Details for Benzoic acid methylester
Benzoic acid methylester
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
93-58-3 |
EC NO: |
202-259-7 |
Molecular Formula: |
C8H8O2 |
Molecular Weight: |
136.1479 |
Specification: |
|
InChI: |
InChI=1/C8H8O2/c1-10-8(9)7-5-3-2-4-6-7/h2-6H,1H3 |
Synonyms: |
Benzoic acid methyl ester;clorius;essence of niobe;methyl benzenecarboxylate;Niobe oil;Oil of niobe;oniobe oil;oxidate le; |
Molecular Structure: |
|
if you are sourcing Benzoic acid methylester from France ,just feel free to inquire