Details for Isovaleric acid ethylester
![](/images/home/newal1.gif)
Isovaleric acid ethylester
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
108-64-5 |
EC NO: |
203-602-3 |
Molecular Formula: |
C7H14O2 |
Molecular Weight: |
130.1849 |
Specification: |
|
InChI: |
InChI=1/C7H14O2/c1-4-9-7(8)5-6(2)3/h6H,4-5H2,1-3H3 |
Synonyms: |
Ethyl isopentanoate;Isovaleric acid ethyl ester;Isovaleriansaeureethylester;Ethyl 3-methylbutyrate;3-Methylbutyric acid ethyl ester;ethyl 3-methylbutanoate; |
Molecular Structure: |
![Isovaleric acid ethylester 108-64-5](https://images-a.chemnet.com/suppliers/chembase/335/3358.gif) |
if you are sourcing Isovaleric acid ethylester from France ,just feel free to inquire