Details for Myristic acid methylester
![](/images/home/newal1.gif)
Myristic acid methylester
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
124-10-7 |
EC NO: |
204-680-1 |
Molecular Formula: |
C15H30O2 |
Molecular Weight: |
242.40 |
Specification: |
|
InChI: |
InChI=1/C15H30O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17-2/h3-14H2,1-2H3 |
Synonyms: |
Methyl tetradecanoate;methyl myristate 99%;Myristic Acid Methyl Ester;Tetradecanoic acid methyl ester; |
Molecular Structure: |
![Myristic acid methylester 124-10-7](https://images-a.chemnet.com/suppliers/chembase/446/4461.gif) |
if you are sourcing Myristic acid methylester from France ,just feel free to inquire