Details for 1-Chloroethyl Chloroformate

1-Chloroethyl Chloroformate
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
50893-53-3 |
EC NO: |
256-834-2 |
Molecular Formula: |
C3H4Cl2O2 |
Molecular Weight: |
142.9687 |
Specification: |
|
InChI: |
InChI=1/C3H4Cl2O2/c1-2(4)7-3(5)6/h2H,1H3/t2-/m1/s1 |
Synonyms: |
1-Chloroethyl chloridocarbonate;Carbonochloridic acid, 1-chloroethyl ester;CHLOROFORMIC ACID 1-CHLOROETHYL ESTER;ACE-CL;1-Chloroethylchloroformate;1-Chloroethyl chloroformate (JCC);1-chloroethyl carbonochloridate;(1R)-1-chloroethyl chlorocarbonate;(1S)-1-chloroethyl chlorocarbonate;1-Chloro Ethyl Chloroformate; |
Molecular Structure: |
 |
if you are sourcing 1-Chloroethyl Chloroformate from China ,just feel free to inquire