Details for Chloromethyl Isopropyl Carbonate
![](/images/home/newal1.gif)
Chloromethyl Isopropyl Carbonate
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
35180-01-9 |
EC NO: |
|
Molecular Formula: |
C5H9ClO3 |
Molecular Weight: |
152.5762 |
Specification: |
|
InChI: |
InChI=1/C5H9ClO3/c1-4(2)9-5(7)8-3-6/h4H,3H2,1-2H3 |
Synonyms: |
i-Propyl Chloromethyl Carbonate;Chloromethyl-2-propyl Carbonate;CMIC,for Tenofovir;chloromethyl propan-2-yl carbonate;Chloromethyl propyl carbonate; |
Molecular Structure: |
![Chloromethyl Isopropyl Carbonate 35180-01-9](https://images-a.chemnet.com/suppliers/chembase/176/176003_1.gif) |
if you are sourcing Chloromethyl Isopropyl Carbonate from China ,just feel free to inquire