Details for 2-thiopheneacetic acid

2-thiopheneacetic acid
111Category: |
Food and Feed additives |
|
CAS NO: |
1918-77-0 |
EC NO: |
217-639-8 |
Molecular Formula: |
C6H5O2S |
Molecular Weight: |
141.1682 |
Specification: |
|
InChI: |
InChI=1/C6H6O2S/c7-6(8)4-5-2-1-3-9-5/h1-3H,4H2,(H,7,8)/p-1 |
Synonyms: |
2-Thenylacetic acid;Thiophene-2-acetic acid, (2-Thienylacetic acid);2-Thienylacetic acid;thiophen-2-acetic acid;Thiophene-2-acetic acid;Thien-2-ylacetate;thiophen-2-ylacetic acid;thiophen-2-ylacetate;RARECHEM AL BO 0215;TIMTEC-BB SBB004145;2-Thiophene Acetic Acid; |
Molecular Structure: |
 |
if you are sourcing 2-thiopheneacetic acid from China ,just feel free to inquire