Details for 2-hydroxyacetophenone
2-hydroxyacetophenone
| 111Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
118-93-4 |
| EC NO: |
204-288-0 |
| Molecular Formula: |
C8H8O2 |
| Molecular Weight: |
136.1479 |
| Specification: |
|
| InChI: |
InChI=1/C8H8O2/c1-6(9)7-4-2-3-5-8(7)10/h2-5,10H,1H3 |
| Synonyms: |
1-(2-Hydroxyphenyl)ethanone;o-Acetyl phenol;1-(3-hydroxyphenyl)ethanone;2-Hydroxyphenyl methyl ketone;FEMA 3548;AKOS 90575;AKOS BBS-00003239;2-HYDROXYPHENYL METHYL KETONE;2-ACETOPHENOL;O-HYDROXYACETOPHENONE;O-ACETOPHENOL;2'-Hydroxy acetophenone;2-Hydroxyacetophenone;2-Acetylphenol;Ortho-Hydroxyacetophenone; |
| Molecular Structure: |
 |
if you are sourcing 2-hydroxyacetophenone from China ,just feel free to inquire
CN
China Suppliers > karssenchem > 
Search Product