Details for 3-chloroaniline
3-chloroaniline
| 111Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
108-42-9 |
| EC NO: |
203-581-0 |
| Molecular Formula: |
C6H6ClN |
| Molecular Weight: |
127.57334 |
| Specification: |
|
| InChI: |
InChI=1/C6H6ClN.ClH/c7-5-2-1-3-6(8)4-5;/h1-4H,8H2;1H |
| Synonyms: |
3-Chlorobenzenamine;fast orange GC base;m-Chloroaniline;3-chlorobenzeneamine;m-chloro aniline;3-chloroaniline hydrochloride (1:1);3-Halide;Meta Chloro Aniline; |
| Molecular Structure: |
 |
if you are sourcing 3-chloroaniline from China ,just feel free to inquire
CN
China Suppliers > karssenchem > 
Search Product