Details for biphenyl
biphenyl
| 111Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
92-52-4 |
| EC NO: |
202-163-5;270-059-7 |
| Molecular Formula: |
C12H10 |
| Molecular Weight: |
154.21 |
| Specification: |
|
| InChI: |
InChI=1/C12H10/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1-10H |
| Synonyms: |
Diphenyl Mixture;Diphenyl;Diphenyl Mixture;Aromatic hydrocarbons, biphenyl-rich;Biphenyl rich aromatic hydrocarbons;Distilled hydrodealkylized toluene;1,1'-Biphenyl; |
| Molecular Structure: |
 |
if you are sourcing biphenyl from China ,just feel free to inquire
CN
China Suppliers > karssenchem > 
Search Product