Details for N-methyl pyrrolidone

N-methyl pyrrolidone
| Category: |
Intermediates |
|
| CAS NO: |
2687-44-7 |
| EC NO: |
212-828-1 |
| Molecular Formula: |
C5H9NO |
| Molecular Weight: |
99.13 |
| Specification: |
|
| InChI: |
InChI=1/C5H9NO/c1-6-4-2-3-5(6)7/h2-4H2,1H3 |
| Synonyms: |
N-Methylpyrrolidone;1-Methyl-2-pyrrolidinone, anhydrous;NMP;N-Methyl pyrrolidone;N-Methyl-2-pyrrolidone;N-Methyl-2-pyrrolidinone;N-Methyl-pyrrolidone;NMP-EL;NMP-T;N-METHYLPYRROLIDNONE;N-METHYLPYRROLIDINONE;N-METHYLPYRROLID-2-ONE;N-METHYLPYROLIDONE;M-PYROL(R);1-Methyl-2-pyrrolidone; |
| Molecular Structure: |
 |
if you are sourcing N-methyl pyrrolidone from China ,just feel free to inquire